Difference between revisions of "Tiso gene 12104"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11523 CPD-11523] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...")
(Created page with "Category:Gene == Gene Tiso_gene_12104 == * right end position: ** 3222 * transcription direction: ** NEGATIVE * left end position: ** 22 * centisome position: ** 0.3015764...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11523 CPD-11523] ==
+
== Gene Tiso_gene_12104 ==
−
* smiles:
+
* right end position:
−
** CCC=CCC4(C(=O)CCC(CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
** 3222
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OMDQVIUYDJAWHX-ZMWLRFEFSA-J
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** OPC6-3-hydroxyacyl-CoA
+
** 22
−
* molecular weight:
+
* centisome position:
−
** 1027.866    
+
** 0.30157644    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10702]]
+
* Reaction: [[PHOSGLYPHOS-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-experimental_annotation]]
−
* [[RXN-10704]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-1042]]
 +
* [[PWY66-399]]
 +
* [[GLUCONEO-PWY]]
 +
* [[SUCSYN-PWY]]
 +
* [[PWY-6901]]
 +
* [[P124-PWY]]
 +
* [[GLYCOLYSIS]]
 +
* [[PWY-6886]]
 +
* [[CALVIN-PWY]]
 +
* [[ANAGLYCOLYSIS-PWY]]
 +
* [[P122-PWY]]
 +
* [[P185-PWY]]
 +
* [[PWY-5484]]
 +
* [[PWY-7003]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=3222}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237226 44237226]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: left end position=22}}
−
{{#set: inchi key=InChIKey=OMDQVIUYDJAWHX-ZMWLRFEFSA-J}}
+
{{#set: centisome position=0.30157644   }}
−
{{#set: common name=OPC6-3-hydroxyacyl-CoA}}
+
{{#set: reaction associated=PHOSGLYPHOS-RXN}}
−
{{#set: molecular weight=1027.866   }}
+
{{#set: pathway associated=PWY-1042|PWY66-399|GLUCONEO-PWY|SUCSYN-PWY|PWY-6901|P124-PWY|GLYCOLYSIS|PWY-6886|CALVIN-PWY|ANAGLYCOLYSIS-PWY|P122-PWY|P185-PWY|PWY-5484|PWY-7003}}
−
{{#set: consumed by=RXN-10702}}
+
−
{{#set: produced by=RXN-10704}}
+

Latest revision as of 20:52, 21 March 2018

Gene Tiso_gene_12104

  • right end position:
    • 3222
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 22
  • centisome position:
    • 0.30157644
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12104&oldid=44255"