Difference between revisions of "Tiso gene 12272"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHACRYLYL-COA METHACRYLYL-COA] == * smiles: ** C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R00946 R00946] == * direction: ** LEFT-TO-RIGHT * common name: ** R193 * Synonym(s): == Reaction F...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHACRYLYL-COA METHACRYLYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R00946 R00946] ==
−
* smiles:
+
* direction:
−
** C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=NPALUEYCDZWBOV-NDZSKPAWSA-J
+
 
* common name:
 
* common name:
−
** methylacrylyl-CoA
+
** R193
−
* molecular weight:
+
−
** 831.577   
+
 
* Synonym(s):
 
* Synonym(s):
−
** methacrylyl-CoA
 
−
** 2-methylprop-2-enoyl-CoA
 
−
** methacrylyl-coenzyme A
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[MEPROPCOA-FAD-RXN]]
+
** 1.0 [[HOMO-CYS]][c] '''+''' 1.0 [[5-METHYL-THF]][c] '''=>''' 1.0 [[MET]][c] '''+''' 1.0 [[THF]][c]
−
* [[MCDH]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1.0 L-homocysteine[c] '''+''' 1.0 N5-methyl-tetrahydropteroyl mono-L-glutamate[c] '''=>''' 1.0 L-methionine[c] '''+''' 1.0 tetrahydropteroyl mono-L-glutamate[c]
−
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_1602]]
 +
** [[pantograph]]-[[synechocystis]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[synechocystis]]
 
== External links  ==
 
== External links  ==
−
* CAS : 6008-91-9
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=R193}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53262325 53262325]
+
{{#set: gene associated=Tiso_gene_1602}}
−
* CHEBI:
+
{{#set: in pathway=}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62500 62500]
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction tool=pantograph}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03460 C03460]
+
{{#set: reconstruction source=synechocystis}}
−
* HMDB : HMDB01011
+
−
{{#set: smiles=C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C}}
+
−
{{#set: inchi key=InChIKey=NPALUEYCDZWBOV-NDZSKPAWSA-J}}
+
−
{{#set: common name=methylacrylyl-CoA}}
+
−
{{#set: molecular weight=831.577    }}
+
−
{{#set: common name=methacrylyl-CoA|2-methylprop-2-enoyl-CoA|methacrylyl-coenzyme A}}
+
−
{{#set: produced by=MEPROPCOA-FAD-RXN|MCDH}}
+
−
{{#set: consumed or produced by=METHYLACYLYLCOA-HYDROXY-RXN}}
+

Revision as of 17:34, 10 January 2018

Reaction R00946

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • R193
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 L-homocysteine[c] + 1.0 N5-methyl-tetrahydropteroyl mono-L-glutamate[c] => 1.0 L-methionine[c] + 1.0 tetrahydropteroyl mono-L-glutamate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12272&oldid=13605"