Difference between revisions of "Tiso gene 12514"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATUD ATUD] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:UDP phosphotransferase * Synonym(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-558 CPD-558] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATUD ATUD] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-558 CPD-558] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=LYCRXMTYUZDUGA-UYRKPTJQSA-I
 
* common name:
 
* common name:
−
** ATP:UDP phosphotransferase
+
** pimeloyl-CoA
 +
* molecular weight:
 +
** 904.649   
 
* Synonym(s):
 
* Synonym(s):
 +
** 6-carboxyhexanoyl-CoA
 +
** pimelyl-CoA
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[7KAPSYN-RXN]]
−
** 1.0 [[UDP]][c] '''+''' 1.0 [[ATP]][c] '''=>''' 1.0 [[ADP]][c] '''+''' 1.0 [[UTP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 UDP[c] '''+''' 1.0 ATP[c] '''=>''' 1.0 ADP[c] '''+''' 1.0 UTP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_13128]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_16529]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=ATP:UDP phosphotransferase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266589 45266589]
−
{{#set: gene associated=Tiso_gene_13128|Tiso_gene_16529}}
+
* CHEBI:
−
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57360 57360]
−
{{#set: reconstruction category=orthology}}
+
* BIGG : pmcoa
−
{{#set: reconstruction tool=pantograph}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=creinhardtii}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01063 C01063]
 +
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
 +
{{#set: inchi key=InChIKey=LYCRXMTYUZDUGA-UYRKPTJQSA-I}}
 +
{{#set: common name=pimeloyl-CoA}}
 +
{{#set: molecular weight=904.649    }}
 +
{{#set: common name=6-carboxyhexanoyl-CoA|pimelyl-CoA}}
 +
{{#set: consumed by=7KAPSYN-RXN}}

Revision as of 19:54, 18 March 2018

Metabolite CPD-558

  • smiles:
    • CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=LYCRXMTYUZDUGA-UYRKPTJQSA-I
  • common name:
    • pimeloyl-CoA
  • molecular weight:
    • 904.649
  • Synonym(s):
    • 6-carboxyhexanoyl-CoA
    • pimelyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12514&oldid=27699"