Difference between revisions of "Tiso gene 12997"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARAOXON PARAOXON] == * smiles: ** CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O * inchi key: ** In...") |
(Created page with "Category:Gene == Gene Tiso_gene_12997 == * right end position: ** 11370 * transcription direction: ** NEGATIVE * left end position: ** 9062 * centisome position: ** 78.296...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_12997 == |
− | * | + | * right end position: |
− | ** | + | ** 11370 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 9062 |
− | * | + | * centisome position: |
− | ** | + | ** 78.29618 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[ARGININE--TRNA-LIGASE-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[TRNA-CHARGING-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=11370}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=9062}} | |
− | + | {{#set: centisome position=78.29618 }} | |
− | + | {{#set: reaction associated=ARGININE--TRNA-LIGASE-RXN}} | |
− | + | {{#set: pathway associated=TRNA-CHARGING-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:11, 21 March 2018
Gene Tiso_gene_12997
- right end position:
- 11370
- transcription direction:
- NEGATIVE
- left end position:
- 9062
- centisome position:
- 78.29618
- Synonym(s):
Reactions associated
- Reaction: ARGININE--TRNA-LIGASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation