Difference between revisions of "Tiso gene 13369"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19203 CPD-19203] == * smiles: ** C(O)C(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C([O-])=O)C2(C...")
 
(Created page with "Category:Gene == Gene Tiso_gene_13369 == * right end position: ** 4659 * transcription direction: ** POSITIVE * left end position: ** 3958 * centisome position: ** 62.3601...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19203 CPD-19203] ==
+
== Gene Tiso_gene_13369 ==
−
* smiles:
+
* right end position:
−
** C(O)C(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C([O-])=O)C2(C=CC(O)=CC=2)
+
** 4659
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZYPJZNYMRGJBEP-XHSDSOJGSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** D-4-hydroxyphenylglycine-L-seryl-L 4-hydroxyphenylglycine
+
** 3958
−
* molecular weight:
+
* centisome position:
−
** 403.391    
+
** 62.36017    
 
* Synonym(s):
 
* Synonym(s):
−
** D-pHPG-L-Ser-L-pHPG
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[1.3.99.23-RXN]]
−
* [[RXN-17832]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[R95]]
 +
** Source: [[orthology-synechocystis]]
 +
* Reaction: [[R96]]
 +
** Source: [[orthology-synechocystis]]
 +
* Reaction: [[RXN-8042]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-6475]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=C(O)C(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C([O-])=O)C2(C=CC(O)=CC=2)}}
+
{{#set: right end position=4659}}
−
{{#set: inchi key=InChIKey=ZYPJZNYMRGJBEP-XHSDSOJGSA-N}}
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: common name=D-4-hydroxyphenylglycine-L-seryl-L 4-hydroxyphenylglycine}}
+
{{#set: left end position=3958}}
−
{{#set: molecular weight=403.391   }}
+
{{#set: centisome position=62.36017   }}
−
{{#set: common name=D-pHPG-L-Ser-L-pHPG}}
+
{{#set: reaction associated=1.3.99.23-RXN|R95|R96|RXN-8042}}
−
{{#set: produced by=RXN-17832}}
+
{{#set: pathway associated=PWY-6475}}

Latest revision as of 20:42, 21 March 2018

Gene Tiso_gene_13369

  • right end position:
    • 4659
  • transcription direction:
    • POSITIVE
  • left end position:
    • 3958
  • centisome position:
    • 62.36017
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_13369&oldid=43365"