Difference between revisions of "Tiso gene 13527"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12365 CPD-12365] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=...")
(Created page with "Category:Gene == Gene Tiso_gene_14187 == * left end position: ** 327 * transcription direction: ** NEGATIVE * right end position: ** 3477 * centisome position: ** 5.641822...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12365 CPD-12365] ==
+
== Gene Tiso_gene_14187 ==
* smiles:
+
* left end position:
** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
+
** 327
* inchi key:
+
* transcription direction:
** InChIKey=AQIVLFLYHYFRKU-VPENINKCSA-L
+
** NEGATIVE
* common name:
+
* right end position:
** 8-oxo-dGMP
+
** 3477
* molecular weight:
+
* centisome position:
** 361.207    
+
** 5.641822    
 
* Synonym(s):
 
* Synonym(s):
** 8-oxo-7,8-dihydro-2'-dGMP
 
** 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-monophosphate
 
** 8-oxo-deoxyguanosine-monophosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[1.1.3.37-RXN]]
== Reaction(s) of unknown directionality ==
+
** in-silico_annotation
* [[RXN-14205]]
+
***ec-number
 +
* [[1.1.3.41-RXN]]
 +
** in-silico_annotation
 +
***automated-name-match
 +
* [[RXN-9926]]
 +
** in-silico_annotation
 +
***automated-name-match
 +
* [[UDPNACETYLMURAMATEDEHYDROG-RXN]]
 +
** in-silico_annotation
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY3O-6]]
 +
* [[PWY-6386]]
 +
* [[PWY-6387]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=327}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173535 46173535]
+
{{#set: transcription direction=NEGATIVE}}
* CHEBI:
+
{{#set: right end position=3477}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63224 63224]
+
{{#set: centisome position=5.641822   }}
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}}
+
{{#set: reaction associated=1.1.3.37-RXN|1.1.3.41-RXN|RXN-9926|UDPNACETYLMURAMATEDEHYDROG-RXN}}
{{#set: inchi key=InChIKey=AQIVLFLYHYFRKU-VPENINKCSA-L}}
+
{{#set: pathway associated=PWY3O-6|PWY-6386|PWY-6387}}
{{#set: common name=8-oxo-dGMP}}
+
{{#set: molecular weight=361.207   }}
+
{{#set: common name=8-oxo-7,8-dihydro-2'-dGMP|8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-monophosphate|8-oxo-deoxyguanosine-monophosphate}}
+
{{#set: consumed or produced by=RXN-14205}}
+

Revision as of 01:13, 19 March 2018

Gene Tiso_gene_14187

  • left end position:
    • 327
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3477
  • centisome position:
    • 5.641822
  • Synonym(s):

Reactions associated

Pathways associated

External links