Difference between revisions of "Tiso gene 14187"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] == * smiles: ** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2)) * inchi key: ** In...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-147 RXN1F-147] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-147 RXN1F-147] ==
−
* smiles:
+
* direction:
−
** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N
+
** [http://enzyme.expasy.org/EC/5.5.1.18 EC-5.5.1.18]
−
* common name:
+
−
** serotonin O-sulfate
+
−
* molecular weight:
+
−
** 256.276   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 5-hydroxytryptamine O-sulfate
 
−
** 3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate
 
−
** 1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-10777]]
+
** 1 [[CPD1F-114]][c] '''=>''' 1 [[CPD1F-115]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 all-trans-lycopene[c] '''=>''' 1 δ-carotene[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_8263]]
 +
** [[pantograph]]-[[athaliana]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_1547]]
 +
** [[pantograph]]-[[athaliana]]
 +
* [[Tiso_gene_11980]]
 +
** [[pantograph]]-[[athaliana]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[Tiso_gene_3577]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_4457]]
 +
** [[pantograph]]-[[athaliana]]
 +
* [[Tiso_gene_6282]]
 +
** [[pantograph]]-[[athaliana]]
 +
== Pathways  ==
 +
* [[PWY-5946]], δ-carotene biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5946 PWY-5946]
 +
** '''1''' reactions found over '''1''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[creinhardtii]]
 +
*** [[athaliana]]
 +
*** [[esiliculosus]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=152151 152151]
+
** [http://www.genome.jp/dbget-bin/www_bget?R06963 R06963]
−
* CHEMSPIDER:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.chemspider.com/Chemical-Structure.134104.html 134104]
+
{{#set: ec number=EC-5.5.1.18}}
−
{{#set: smiles=C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))}}
+
{{#set: gene associated=Tiso_gene_8263|Tiso_gene_1547|Tiso_gene_11980|Tiso_gene_3577|Tiso_gene_4457|Tiso_gene_6282}}
−
{{#set: inchi key=InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N}}
+
{{#set: in pathway=PWY-5946}}
−
{{#set: common name=serotonin O-sulfate}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: molecular weight=256.276    }}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=5-hydroxytryptamine O-sulfate|3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate|1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)}}
+
{{#set: reconstruction source=creinhardtii|athaliana|esiliculosus}}
−
{{#set: produced by=RXN-10777}}
+

Revision as of 18:33, 10 January 2018

Reaction RXN1F-147

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 all-trans-lycopene[c] => 1 δ-carotene[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5946, δ-carotene biosynthesis: PWY-5946
    • 1 reactions found over 1 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_14187&oldid=18333"