Difference between revisions of "Tiso gene 14187"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] == * smiles: ** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2)) * inchi key: ** In...") |
(Created page with "Category:Gene == Gene Tiso_gene_14187 == * right end position: ** 3477 * transcription direction: ** NEGATIVE * left end position: ** 327 * centisome position: ** 5.641822...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_14187 == |
− | * | + | * right end position: |
− | ** | + | ** 3477 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 327 |
− | * | + | * centisome position: |
− | ** | + | ** 5.641822 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[1.1.3.37-RXN]] | |
− | * [[RXN- | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | * Reaction: [[1.1.3.41-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-9926]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[UDPNACETYLMURAMATEDEHYDROG-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY3O-6]] | ||
+ | * [[PWY-6386]] | ||
+ | * [[PWY-6387]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3477}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=327}} | |
− | + | {{#set: centisome position=5.641822 }} | |
− | {{#set: | + | {{#set: reaction associated=1.1.3.37-RXN|1.1.3.41-RXN|RXN-9926|UDPNACETYLMURAMATEDEHYDROG-RXN}} |
− | {{#set: | + | {{#set: pathway associated=PWY3O-6|PWY-6386|PWY-6387}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:21, 21 March 2018
Gene Tiso_gene_14187
- right end position:
- 3477
- transcription direction:
- NEGATIVE
- left end position:
- 327
- centisome position:
- 5.641822
- Synonym(s):
Reactions associated
- Reaction: 1.1.3.37-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: 1.1.3.41-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: RXN-9926
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: UDPNACETYLMURAMATEDEHYDROG-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation