Difference between revisions of "Tiso gene 14455"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-CISCIS-MUCONATE 3-HYDROXY-CISCIS-MUCONATE] == * smiles: ** C(=CC(=O)[O-])C(O)=CC(=O)[...")
 
(Created page with "Category:Gene == Gene Tiso_gene_14455 == * right end position: ** 5609 * transcription direction: ** POSITIVE * left end position: ** 4453 * centisome position: ** 78.8560...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-CISCIS-MUCONATE 3-HYDROXY-CISCIS-MUCONATE] ==
+
== Gene Tiso_gene_14455 ==
−
* smiles:
+
* right end position:
−
** C(=CC(=O)[O-])C(O)=CC(=O)[O-]
+
** 5609
−
* inchi key:
+
* transcription direction:
−
** InChIKey=DLKZGMNZEDNHKO-BXTBVDPRSA-L
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 3-hydroxy-cis,cis-muconate
+
** 4453
−
* molecular weight:
+
* centisome position:
−
** 156.095    
+
** 78.856026    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[1.8.4.12-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-9922]]
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=5609}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54729369 54729369]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=4453}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58139 58139]
+
{{#set: centisome position=78.856026   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=1.8.4.12-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03676 C03676]
+
−
{{#set: smiles=C(=CC(=O)[O-])C(O)=CC(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=DLKZGMNZEDNHKO-BXTBVDPRSA-L}}
+
−
{{#set: common name=3-hydroxy-cis,cis-muconate}}
+
−
{{#set: molecular weight=156.095   }}
+
−
{{#set: consumed or produced by=RXN-9922}}
+

Latest revision as of 21:19, 21 March 2018

Gene Tiso_gene_14455

  • right end position:
    • 5609
  • transcription direction:
    • POSITIVE
  • left end position:
    • 4453
  • centisome position:
    • 78.856026
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_14455&oldid=47721"