Difference between revisions of "Tiso gene 1453"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12365 CPD-12365] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=...")
 
(Created page with "Category:Gene == Gene Tiso_gene_1453 == * Synonym(s): == Reactions associated == * Reaction: ADENYL-KIN-RXN ** Source: orthology-esiliculosus * Reaction: THMPPP...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12365 CPD-12365] ==
+
== Gene Tiso_gene_1453 ==
* smiles:
+
** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
+
* inchi key:
+
** InChIKey=AQIVLFLYHYFRKU-VPENINKCSA-L
+
* common name:
+
** 8-oxo-dGMP
+
* molecular weight:
+
** 361.207   
+
 
* Synonym(s):
 
* Synonym(s):
** 8-oxo-7,8-dihydro-2'-dGMP
 
** 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-monophosphate
 
** 8-oxo-deoxyguanosine-monophosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ADENYL-KIN-RXN]]
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-esiliculosus]]
* [[RXN-14205]]
+
* Reaction: [[THMPPPT]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[TMDPT]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 +
* [[PWY-7219]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=ADENYL-KIN-RXN|THMPPPT|TMDPT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173535 46173535]
+
{{#set: pathway associated=PWY-7219}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63224 63224]
+
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}}
+
{{#set: inchi key=InChIKey=AQIVLFLYHYFRKU-VPENINKCSA-L}}
+
{{#set: common name=8-oxo-dGMP}}
+
{{#set: molecular weight=361.207    }}
+
{{#set: common name=8-oxo-7,8-dihydro-2'-dGMP|8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-monophosphate|8-oxo-deoxyguanosine-monophosphate}}
+
{{#set: consumed or produced by=RXN-14205}}
+

Latest revision as of 21:22, 21 March 2018

Gene Tiso_gene_1453

  • Synonym(s):

Reactions associated

Pathways associated

External links