Difference between revisions of "Tiso gene 14568"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-731 CPD-731] == * smiles: ** CCC=CCC1(C(=O)CCC1CC([O-])=O) * inchi key: ** InChIKey=ZNJFBWY...") |
(Created page with "Category:Gene == Gene Tiso_gene_17287 == * right end position: ** 3640 * transcription direction: ** NEGATIVE * left end position: ** 734 * centisome position: ** 19.29040...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_17287 == |
− | * | + | * right end position: |
− | ** | + | ** 3640 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 734 |
− | * | + | * centisome position: |
− | ** | + | ** 19.290407 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[GCVP-RXN]] | |
− | * [[RXN- | + | ** Source: [[orthology-esiliculosus]] |
− | == | + | * Reaction: [[GCVT-RXN]] |
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-6321]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[GLYCINE-SYN2-PWY]] | ||
+ | * [[GLYCLEAV-PWY]] | ||
+ | * [[PWY-3841]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3640}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=734}} | |
− | + | {{#set: centisome position=19.290407 }} | |
− | + | {{#set: reaction associated=GCVP-RXN|GCVT-RXN|RXN-6321}} | |
− | + | {{#set: pathway associated=GLYCINE-SYN2-PWY|GLYCLEAV-PWY|PWY-3841}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:54, 21 March 2018
Gene Tiso_gene_17287
- right end position:
- 3640
- transcription direction:
- NEGATIVE
- left end position:
- 734
- centisome position:
- 19.290407
- Synonym(s):
Reactions associated
- Reaction: GCVP-RXN
- Source: orthology-esiliculosus
- Reaction: GCVT-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: RXN-6321
- Source: orthology-esiliculosus