Difference between revisions of "Tiso gene 14707"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15685 CPD-15685] == * smiles: ** CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4366 RXNQT-4366] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF ** para-nitrobenzyl_e...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15685 CPD-15685] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4366 RXNQT-4366] ==
* smiles:
+
* direction:
** CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=XPVHXTGUZGACRU-MCFMHTHASA-J
+
 
* common name:
 
* common name:
** 2-trans, 5-cis, 7-trans-tetradecatrienoyl-CoA
+
** ORF
* molecular weight:
+
** para-nitrobenzyl_esterase
** 967.814   
+
** alpha_beta_hydrolase_fold_protein
 +
** alpha_beta_hydrolase
 +
** sialate_o-acetylesterase-like_protein
 +
** serine_esterase
 +
** lysophospholipase
 +
** protein_chloroplastic
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/3.1.1.1 EC-3.1.1.1]
 
* Synonym(s):
 
* Synonym(s):
** 2E, 5Z, 7E-tetradecatrienoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-14796]]
+
** 1 [[CPD-6442]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[METOH]][c] '''+''' 1 [[CPD-110]][c] '''+''' 1 [[PROTON]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 methylsalicylate[c] '''+''' 1 H2O[c] '''=>''' 1 methanol[c] '''+''' 1 salicylate[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_19778]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_4650]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_16518]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_2556]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_12686]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_10066]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_1537]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_1538]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_1922]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_4606]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_9429]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_11351]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[Tiso_gene_17029]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657959 90657959]
+
{{#set: common name=ORF}}
{{#set: smiles=CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=para-nitrobenzyl_esterase}}
{{#set: inchi key=InChIKey=XPVHXTGUZGACRU-MCFMHTHASA-J}}
+
{{#set: common name=alpha_beta_hydrolase_fold_protein}}
{{#set: common name=2-trans, 5-cis, 7-trans-tetradecatrienoyl-CoA}}
+
{{#set: common name=alpha_beta_hydrolase}}
{{#set: molecular weight=967.814    }}
+
{{#set: common name=sialate_o-acetylesterase-like_protein}}
{{#set: common name=2E, 5Z, 7E-tetradecatrienoyl-CoA}}
+
{{#set: common name=serine_esterase}}
{{#set: produced by=RXN-14796}}
+
{{#set: common name=lysophospholipase}}
 +
{{#set: common name=protein_chloroplastic}}
 +
{{#set: ec number=EC-3.1.1.1}}
 +
{{#set: gene associated=Tiso_gene_19778|Tiso_gene_4650|Tiso_gene_16518|Tiso_gene_2556|Tiso_gene_12686|Tiso_gene_10066|Tiso_gene_1537|Tiso_gene_1538|Tiso_gene_1922|Tiso_gene_4606|Tiso_gene_9429|Tiso_gene_11351|Tiso_gene_17029}}
 +
{{#set: in pathway=}}
 +
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Revision as of 16:57, 21 March 2018

Reaction RXNQT-4366

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ORF
    • para-nitrobenzyl_esterase
    • alpha_beta_hydrolase_fold_protein
    • alpha_beta_hydrolase
    • sialate_o-acetylesterase-like_protein
    • serine_esterase
    • lysophospholipase
    • protein_chloroplastic
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 methylsalicylate[c] + 1 H2O[c] => 1 methanol[c] + 1 salicylate[c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links