Difference between revisions of "Tiso gene 14966"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPATE TROPATE] == * smiles: ** C(O)C(C1(C=CC=CC=1))C([O-])=O * inchi key: ** InChIKey=JACRWUW...") |
(Created page with "Category:Gene == Gene Tiso_gene_14966 == * right end position: ** 5001 * transcription direction: ** POSITIVE * left end position: ** 126 * centisome position: ** 2.367976...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_14966 == |
− | * | + | * right end position: |
− | ** | + | ** 5001 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 126 |
− | * | + | * centisome position: |
− | ** | + | ** 2.367976 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[2.7.1.68-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
+ | * [[PWY-6352]] | ||
+ | * [[PWY-6351]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=5001}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=126}} | |
− | + | {{#set: centisome position=2.367976 }} | |
− | + | {{#set: reaction associated=2.7.1.68-RXN}} | |
− | + | {{#set: pathway associated=PWY-6352|PWY-6351}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:53, 21 March 2018
Gene Tiso_gene_14966
- right end position:
- 5001
- transcription direction:
- POSITIVE
- left end position:
- 126
- centisome position:
- 2.367976
- Synonym(s):
Reactions associated
- Reaction: 2.7.1.68-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation