Difference between revisions of "Tiso gene 15060"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6994 CPD-6994] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O) * in...")
(Created page with "Category:Gene == Gene Tiso_gene_15060 == * right end position: ** 4815 * transcription direction: ** POSITIVE * left end position: ** 305 * centisome position: ** 5.798479...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6994 CPD-6994] ==
+
== Gene Tiso_gene_15060 ==
−
* smiles:
+
* right end position:
−
** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O)
+
** 4815
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SBHXYTNGIZCORC-ZDUSSCGKSA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** (2S)-eriodictyol
+
** 305
−
* molecular weight:
+
* centisome position:
−
** 287.248    
+
** 5.798479    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-7775]]
+
* Reaction: [[2.7.11.24-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=4815}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657147 90657147]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=305}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28412 28412]
+
{{#set: centisome position=5.798479   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=2.7.11.24-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05631 C05631]
+
−
* HMDB : HMDB05810
+
−
{{#set: smiles=C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O)}}
+
−
{{#set: inchi key=InChIKey=SBHXYTNGIZCORC-ZDUSSCGKSA-M}}
+
−
{{#set: common name=(2S)-eriodictyol}}
+
−
{{#set: molecular weight=287.248   }}
+
−
{{#set: consumed by=RXN-7775}}
+

Latest revision as of 21:14, 21 March 2018

Gene Tiso_gene_15060

  • right end position:
    • 4815
  • transcription direction:
    • POSITIVE
  • left end position:
    • 305
  • centisome position:
    • 5.798479
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15060&oldid=47072"