Difference between revisions of "Tiso gene 15276"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12014 CPD-12014] == * smiles: ** CC(=O)NCCC1(=CNC2(C1=CC(OC)=C(O)C=2)) * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene Tiso_gene_15276 == * right end position: ** 4966 * transcription direction: ** POSITIVE * left end position: ** 70 * centisome position: ** 1.3666537...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_15276 == |
− | * | + | * right end position: |
− | ** | + | ** 4966 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 70 |
− | * | + | * centisome position: |
− | ** | + | ** 1.3666537 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[NADH-DEHYDROG-A-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | ** Source: [[annotation-experimental_annotation]] |
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6692]] | ||
+ | * [[PWY-3781]] | ||
+ | * [[PWY-5083]] | ||
+ | * [[PWY0-1334]] | ||
+ | * [[PWY0-1335]] | ||
+ | * [[PWY-4302]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=4966}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=70}} | |
− | + | {{#set: centisome position=1.3666537 }} | |
− | + | {{#set: reaction associated=NADH-DEHYDROG-A-RXN}} | |
− | + | {{#set: pathway associated=PWY-6692|PWY-3781|PWY-5083|PWY0-1334|PWY0-1335|PWY-4302}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:03, 21 March 2018
Gene Tiso_gene_15276
- right end position:
- 4966
- transcription direction:
- POSITIVE
- left end position:
- 70
- centisome position:
- 1.3666537
- Synonym(s):
Reactions associated
- Reaction: NADH-DEHYDROG-A-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation