Difference between revisions of "Tiso gene 16011"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13576 CPD-13576] == * smiles: ** CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1) * inchi key: *...") |
(Created page with "Category:Gene == Gene Tiso_gene_16011 == * right end position: ** 4176 * transcription direction: ** POSITIVE * left end position: ** 272 * centisome position: ** 5.850720...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_16011 == |
− | * | + | * right end position: |
− | ** | + | ** 4176 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 272 |
− | * | + | * centisome position: |
− | ** | + | ** 5.8507204 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[AIRCARBOXY-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN0-742]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6123]] | ||
+ | * [[PWY-6124]] | ||
+ | * [[PWY-7234]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=4176}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=272}} | |
− | + | {{#set: centisome position=5.8507204 }} | |
− | {{#set: | + | {{#set: reaction associated=AIRCARBOXY-RXN|RXN0-742}} |
− | {{#set: | + | {{#set: pathway associated=PWY-6123|PWY-6124|PWY-7234}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:02, 21 March 2018
Gene Tiso_gene_16011
- right end position:
- 4176
- transcription direction:
- POSITIVE
- left end position:
- 272
- centisome position:
- 5.8507204
- Synonym(s):
Reactions associated
- Reaction: AIRCARBOXY-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: RXN0-742
- Source: orthology-synechocystis