Difference between revisions of "Tiso gene 1604"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] == * smiles: ** C12(NC(=O)NC=1C(=O)NC(=O)N2) * inchi key: ** InChIKey=LEHOTFFKMJEO...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=REDCITCYC REDCITCYC] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=REDCITCYC REDCITCYC] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** TCA cycle VIII (helicobacter) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Krebs cycle |
− | ** | + | ** tricarboxylic acid cycle |
− | ** | + | ** TCA cycle |
+ | ** citric acid cycle | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''6''' reactions found over '''9''' reactions in the full pathway | |
− | * [[ | + | * [[ACONITATEDEHYDR-RXN]] |
− | + | ** 1 associated gene(s): | |
− | * [[ | + | *** [[Tiso_gene_13007]] |
− | * [[ | + | ** 3 reconstruction source(s) associated: |
− | * [[ | + | *** [[annotation-experimental_annotation]] |
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | * [[ACONITATEHYDR-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_13007]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | * [[CITSYN-RXN]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Tiso_gene_18030]] | ||
+ | *** [[Tiso_gene_9601]] | ||
+ | *** [[Tiso_gene_9603]] | ||
+ | *** [[Tiso_gene_9602]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[FUMHYDR-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Tiso_gene_6720]] | ||
+ | *** [[Tiso_gene_3691]] | ||
+ | ** 6 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | * [[ISOCITDEH-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Tiso_gene_18262]] | ||
+ | *** [[Tiso_gene_10809]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXNI-2]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_6754]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=2-OXOGLUTARATE-SYNTHASE-RXN 2-OXOGLUTARATE-SYNTHASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=R601-RXN R601-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXNI-3 RXNI-3] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=TCA cycle VIII (helicobacter)}} | |
− | + | {{#set: common name=Krebs cycle|tricarboxylic acid cycle|TCA cycle|citric acid cycle}} | |
− | + | {{#set: reaction found=6}} | |
− | + | {{#set: total reaction=9}} | |
− | + | {{#set: completion rate=67.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 19:08, 18 March 2018
Pathway REDCITCYC
- taxonomic range:
- common name:
- TCA cycle VIII (helicobacter)
- Synonym(s):
- Krebs cycle
- tricarboxylic acid cycle
- TCA cycle
- citric acid cycle
Reaction(s) found
6 reactions found over 9 reactions in the full pathway
- ACONITATEDEHYDR-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
- ACONITATEHYDR-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- CITSYN-RXN
- 4 associated gene(s):
- 3 reconstruction source(s) associated:
- FUMHYDR-RXN
- 2 associated gene(s):
- 6 reconstruction source(s) associated:
- ISOCITDEH-RXN
- 2 associated gene(s):
- 4 reconstruction source(s) associated:
- RXNI-2
- 1 associated gene(s):
- 2 reconstruction source(s) associated: