Difference between revisions of "Tiso gene 1604"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] == * smiles: ** C12(NC(=O)NC=1C(=O)NC(=O)N2) * inchi key: ** InChIKey=LEHOTFFKMJEO...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=REDCITCYC REDCITCYC] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=REDCITCYC REDCITCYC] ==
−
* smiles:
+
* taxonomic range:
−
** C12(NC(=O)NC=1C(=O)NC(=O)N2)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=LEHOTFFKMJEONL-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** urate
+
** TCA cycle VIII (helicobacter)
−
* molecular weight:
+
−
** 168.112   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2,6,8-trioxypurine
+
** Krebs cycle
−
** purine-2,6,8-(1H,3H,9H)-trione
+
** tricarboxylic acid cycle
−
** 7,9-dihydro-1H-purine-2,6,8(3H)-trione
+
** TCA cycle
 +
** citric acid cycle
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''6''' reactions found over '''9''' reactions in the full pathway
−
* [[XANTHINE-OXIDASE-RXN]]
+
* [[ACONITATEDEHYDR-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
−
* [[URATEtm]]
+
*** [[Tiso_gene_13007]]
−
* [[RXN0-901]]
+
** 3 reconstruction source(s) associated:
−
* [[URATEt]]
+
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
* [[ACONITATEHYDR-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_13007]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[CITSYN-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_18030]]
 +
*** [[Tiso_gene_9601]]
 +
*** [[Tiso_gene_9603]]
 +
*** [[Tiso_gene_9602]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[FUMHYDR-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_6720]]
 +
*** [[Tiso_gene_3691]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[ISOCITDEH-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_18262]]
 +
*** [[Tiso_gene_10809]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXNI-2]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_6754]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2-OXOGLUTARATE-SYNTHASE-RXN 2-OXOGLUTARATE-SYNTHASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R601-RXN R601-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXNI-3 RXNI-3]
 
== External links  ==
 
== External links  ==
−
* CAS : 69-93-2
+
{{#set: taxonomic range=TAX-2}}
−
* Wikipedia : Uric_acid
+
{{#set: common name=TCA cycle VIII (helicobacter)}}
−
* METABOLIGHTS : MTBLC17775
+
{{#set: common name=Krebs cycle|tricarboxylic acid cycle|TCA cycle|citric acid cycle}}
−
* DRUGBANK : DB01696
+
{{#set: reaction found=6}}
−
* PUBCHEM:
+
{{#set: total reaction=9}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229235 44229235]
+
{{#set: completion rate=67.0}}
−
* HMDB : HMDB00289
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00366 C00366]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17775 17775]
+
−
* BIGG : urate
+
−
{{#set: smiles=C12(NC(=O)NC=1C(=O)NC(=O)N2)}}
+
−
{{#set: inchi key=InChIKey=LEHOTFFKMJEONL-UHFFFAOYSA-N}}
+
−
{{#set: common name=urate}}
+
−
{{#set: molecular weight=168.112    }}
+
−
{{#set: common name=2,6,8-trioxypurine|purine-2,6,8-(1H,3H,9H)-trione|7,9-dihydro-1H-purine-2,6,8(3H)-trione}}
+
−
{{#set: produced by=XANTHINE-OXIDASE-RXN}}
+
−
{{#set: consumed or produced by=URATEtm|RXN0-901|URATEt}}
+

Revision as of 19:08, 18 March 2018

Pathway REDCITCYC

  • taxonomic range:
  • common name:
    • TCA cycle VIII (helicobacter)
  • Synonym(s):
    • Krebs cycle
    • tricarboxylic acid cycle
    • TCA cycle
    • citric acid cycle

Reaction(s) found

6 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_1604&oldid=22170"