Difference between revisions of "Tiso gene 16101"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN ASN] == * smiles: ** C(CC(C(=O)[O-])[N+])(N)=O * inchi key: ** InChIKey=DCXYFEDJOCDNAF-REOH...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-TYR-tRNAs Charged-TYR-tRNAs] == * common name: ** an L-tyrosyl-[tRNAtyr] * Synonym(s):...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-TYR-tRNAs Charged-TYR-tRNAs] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** L- | + | ** an L-tyrosyl-[tRNAtyr] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[TYROSINE--TRNA-LIGASE-RXN]] |
− | + | ||
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=an L-tyrosyl-[tRNAtyr]}} | |
− | + | {{#set: produced by=TYROSINE--TRNA-LIGASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name=L- | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + |
Revision as of 15:50, 21 March 2018
Contents
Metabolite Charged-TYR-tRNAs
- common name:
- an L-tyrosyl-[tRNAtyr]
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an L-tyrosyl-[tRNAtyr" cannot be used as a page name in this wiki.