Difference between revisions of "Tiso gene 17059"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-294 CPD-294] == * smiles: ** C(=CC(=O)[O-])C(=O)CC([O-])=O * inchi key: ** InChIKey=SOXXPQL...") |
(Created page with "Category:Gene == Gene Tiso_gene_17059 == * right end position: ** 3560 * transcription direction: ** NEGATIVE * left end position: ** 452 * centisome position: ** 11.45754...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_17059 == |
− | * | + | * right end position: |
− | ** | + | ** 3560 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 452 |
− | * | + | * centisome position: |
− | ** | + | ** 11.4575405 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PYRROLINECARBREDUCT-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | * Reaction: [[RXN66-546]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PROSYN-PWY]] | ||
+ | * [[ARG-PRO-PWY]] | ||
+ | * [[PWY-6344]] | ||
+ | * [[PWY-4981]] | ||
+ | * [[PWY-3341]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3560}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=452}} | |
− | + | {{#set: centisome position=11.4575405 }} | |
− | + | {{#set: reaction associated=PYRROLINECARBREDUCT-RXN|RXN66-546}} | |
− | + | {{#set: pathway associated=PROSYN-PWY|ARG-PRO-PWY|PWY-6344|PWY-4981|PWY-3341}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:53, 21 March 2018
Gene Tiso_gene_17059
- right end position:
- 3560
- transcription direction:
- NEGATIVE
- left end position:
- 452
- centisome position:
- 11.4575405
- Synonym(s):
Reactions associated
- Reaction: PYRROLINECARBREDUCT-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN66-546
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation