Difference between revisions of "Tiso gene 17144"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7214 CPD-7214] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3O)O)O) * i...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4702 PWY-4702] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4702 PWY-4702] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** phytate degradation I |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | * '''2''' reaction(s) found |
− | == Reaction(s) | + | ** [[RXN-7253]] |
− | + | ** [[RXN0-5408]] | |
+ | == Reaction(s) not found == | ||
+ | * '''12''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-7242 RXN-7242] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-7243 RXN-7243] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-7241 RXN-7241] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-7246 RXN-7246] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-7247 RXN-7247] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-7244 RXN-7244] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-7245 RXN-7245] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-7248 RXN-7248] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-7249 RXN-7249] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1001 RXN0-1001] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-7251 RXN-7251] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-7250 RXN-7250] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: common name=phytate degradation I}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: reaction not found=12}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 17:30, 10 January 2018
Pathway PWY-4702
- taxonomic range:
- common name:
- phytate degradation I
- Synonym(s):
Reaction(s) found
Reaction(s) not found
- 12 reaction(s) not found