Difference between revisions of "Tiso gene 17239"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11519 CPD-11519] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
(Created page with "Category:Gene == Gene Tiso_gene_17239 == * right end position: ** 2344 * transcription direction: ** NEGATIVE * left end position: ** 1376 * centisome position: ** 35.8800...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11519 CPD-11519] ==
+
== Gene Tiso_gene_17239 ==
* smiles:
+
* right end position:
** CCC=CCC4(C(=O)CCC(CCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
** 2344
* inchi key:
+
* transcription direction:
** InChIKey=PDDHCVXPABQISO-PEUIIYGWSA-J
+
** NEGATIVE
* common name:
+
* left end position:
** OPC8-3-hydroxyacyl-CoA
+
** 1376
* molecular weight:
+
* centisome position:
** 1055.92    
+
** 35.880054    
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-3-hydroxy-2-enoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-10698]]
+
* Reaction: [[1-PHOSPHATIDYLINOSITOL-KINASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
* [[RXN-10697]]
+
*** Assignment: ec-number
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-6352]]
 +
* [[PWY-6351]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=2344}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237307 44237307]
+
{{#set: transcription direction=NEGATIVE}}
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: left end position=1376}}
{{#set: inchi key=InChIKey=PDDHCVXPABQISO-PEUIIYGWSA-J}}
+
{{#set: centisome position=35.880054   }}
{{#set: common name=OPC8-3-hydroxyacyl-CoA}}
+
{{#set: reaction associated=1-PHOSPHATIDYLINOSITOL-KINASE-RXN}}
{{#set: molecular weight=1055.92   }}
+
{{#set: pathway associated=PWY-6352|PWY-6351}}
{{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-3-hydroxy-2-enoyl-CoA}}
+
{{#set: consumed by=RXN-10698}}
+
{{#set: produced by=RXN-10697}}
+

Latest revision as of 20:34, 21 March 2018

Gene Tiso_gene_17239

  • right end position:
    • 2344
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 1376
  • centisome position:
    • 35.880054
  • Synonym(s):

Reactions associated

Pathways associated

External links