Difference between revisions of "Tiso gene 17333"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15373 CPD-15373] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=GZCGUP...")
(Created page with "Category:Gene == Gene Tiso_gene_17333 == * right end position: ** 3292 * transcription direction: ** POSITIVE * left end position: ** 1391 * centisome position: ** 36.7892...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15373 CPD-15373] ==
+
== Gene Tiso_gene_17333 ==
−
* smiles:
+
* right end position:
−
** [CH](=O)C(O)C(O)C(O)C(O)CO
+
** 3292
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GZCGUPFRVQAUEE-KVTDHHQDSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** aldehydo-D-mannose
+
** 1391
−
* molecular weight:
+
* centisome position:
−
** 180.157    
+
** 36.789207    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14501]]
+
* Reaction: [[GLUTAMIN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
−
* [[1.1.1.255-RXN]]
+
== Pathways associated ==
−
* [[RXN-14500]]
+
* [[GLUTAMINDEG-PWY]]
 +
* [[CITRULBIO-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=3292}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=161658 161658]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=1391}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=37675 37675]
+
{{#set: centisome position=36.789207   }}
−
{{#set: smiles=[CH](=O)C(O)C(O)C(O)C(O)CO}}
+
{{#set: reaction associated=GLUTAMIN-RXN}}
−
{{#set: inchi key=InChIKey=GZCGUPFRVQAUEE-KVTDHHQDSA-N}}
+
{{#set: pathway associated=GLUTAMINDEG-PWY|CITRULBIO-PWY}}
−
{{#set: common name=aldehydo-D-mannose}}
+
−
{{#set: molecular weight=180.157   }}
+
−
{{#set: consumed by=RXN-14501}}
+
−
{{#set: consumed or produced by=1.1.1.255-RXN|RXN-14500}}
+

Latest revision as of 21:01, 21 March 2018

Gene Tiso_gene_17333

  • right end position:
    • 3292
  • transcription direction:
    • POSITIVE
  • left end position:
    • 1391
  • centisome position:
    • 36.789207
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17333&oldid=45293"