Difference between revisions of "Tiso gene 17333"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15373 CPD-15373] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=GZCGUP...") |
(Created page with "Category:Gene == Gene Tiso_gene_17333 == * right end position: ** 3292 * transcription direction: ** POSITIVE * left end position: ** 1391 * centisome position: ** 36.7892...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_17333 == |
− | * | + | * right end position: |
− | ** | + | ** 3292 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 1391 |
− | * | + | * centisome position: |
− | ** | + | ** 36.789207 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[GLUTAMIN-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
− | * [[ | + | == Pathways associated == |
− | * [[ | + | * [[GLUTAMINDEG-PWY]] |
+ | * [[CITRULBIO-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3292}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=1391}} | |
− | + | {{#set: centisome position=36.789207 }} | |
− | {{#set: | + | {{#set: reaction associated=GLUTAMIN-RXN}} |
− | {{#set: | + | {{#set: pathway associated=GLUTAMINDEG-PWY|CITRULBIO-PWY}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:01, 21 March 2018
Gene Tiso_gene_17333
- right end position:
- 3292
- transcription direction:
- POSITIVE
- left end position:
- 1391
- centisome position:
- 36.789207
- Synonym(s):
Reactions associated
- Reaction: GLUTAMIN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation