Difference between revisions of "Tiso gene 17451"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15818 CPD-15818] == * smiles: ** [CH](=O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=PYMYPHUHKU...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=trans-D2-cis-D13-lacceroyl-ACPs trans-D2-cis-D13-lacceroyl-ACPs] == * common name: ** a trans-d...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15818 CPD-15818] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=trans-D2-cis-D13-lacceroyl-ACPs trans-D2-cis-D13-lacceroyl-ACPs] ==
* smiles:
+
** [CH](=O)C(O)C(O)C(O)CO
+
* inchi key:
+
** InChIKey=PYMYPHUHKUWMLA-LMVFSUKVSA-N
+
 
* common name:
 
* common name:
** aldehydo-D-ribose
+
** a trans-delta2-cis-delta13-C32:2-[acp]
* molecular weight:
+
** 150.131   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN1G-299]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-14883]]
 
* [[RXN-14882]]
 
* [[RXN0-5305]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a trans-delta2-cis-delta13-C32:2-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5311110 5311110]
+
{{#set: consumed by=RXN1G-299}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47014 47014]
+
* METABOLIGHTS : MTBLC47014
+
{{#set: smiles=[CH](=O)C(O)C(O)C(O)CO}}
+
{{#set: inchi key=InChIKey=PYMYPHUHKUWMLA-LMVFSUKVSA-N}}
+
{{#set: common name=aldehydo-D-ribose}}
+
{{#set: molecular weight=150.131    }}
+
{{#set: consumed or produced by=RXN-14883|RXN-14882|RXN0-5305}}
+

Revision as of 17:01, 10 January 2018

Metabolite trans-D2-cis-D13-lacceroyl-ACPs

  • common name:
    • a trans-delta2-cis-delta13-C32:2-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a trans-delta2-cis-delta13-C32:2-[acp" cannot be used as a page name in this wiki.