Difference between revisions of "Tiso gene 18433"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] == * smiles: ** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6557 PWY-6557] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6557 PWY-6557] ==
−
* smiles:
+
* taxonomic range:
−
** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
−
* inchi key:
+
−
** InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L
+
 
* common name:
 
* common name:
−
** 15,16-dihydrobiliverdin
+
** glycosaminoglycan-protein linkage region biosynthesis
−
* molecular weight:
+
−
** 582.655   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** heparan sulfate biosynthesis (early stages)
 +
** chondroitin sulfate biosynthesis (early stages)
 +
** GAG-protein linkage region biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[1.3.7.3-RXN]]
+
'''1''' reactions found over '''4''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[2.4.1.135-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_4139]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.133-RXN 2.4.1.133-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.134-RXN 2.4.1.134-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2.4.2.26-RXN 2.4.2.26-RXN]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33208}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243901 25243901]
+
{{#set: common name=glycosaminoglycan-protein linkage region biosynthesis}}
−
* CHEBI:
+
{{#set: common name=heparan sulfate biosynthesis (early stages)|chondroitin sulfate biosynthesis (early stages)|GAG-protein linkage region biosynthesis}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57899 57899]
+
{{#set: reaction found=1}}
−
{{#set: smiles=C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)}}
+
{{#set: total reaction=4}}
−
{{#set: inchi key=InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L}}
+
{{#set: completion rate=25.0}}
−
{{#set: common name=15,16-dihydrobiliverdin}}
+
−
{{#set: molecular weight=582.655    }}
+
−
{{#set: consumed by=1.3.7.3-RXN}}
+

Revision as of 19:19, 18 March 2018

Pathway PWY-6557

  • taxonomic range:
  • common name:
    • glycosaminoglycan-protein linkage region biosynthesis
  • Synonym(s):
    • heparan sulfate biosynthesis (early stages)
    • chondroitin sulfate biosynthesis (early stages)
    • GAG-protein linkage region biosynthesis

Reaction(s) found

1 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18433&oldid=23501"