Difference between revisions of "Tiso gene 18529"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-564 CPD-564] == * smiles: ** C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1) * inchi key: ** InChI...") |
(Created page with "Category:Gene == Gene Tiso_gene_18529 == * right end position: ** 2963 * transcription direction: ** NEGATIVE * left end position: ** 1 * centisome position: ** 3.37495800...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_18529 == |
− | * | + | * right end position: |
− | ** | + | ** 2963 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 1 |
− | * | + | * centisome position: |
− | ** | + | ** 3.37495800e-2 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[1-PHOSPHATIDYLINOSITOL-KINASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6352]] | ||
+ | * [[PWY-6351]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=2963}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=1}} | |
− | + | {{#set: centisome position=3.37495800e-2}} | |
− | + | {{#set: reaction associated=1-PHOSPHATIDYLINOSITOL-KINASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-6352|PWY-6351}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:56, 21 March 2018
Gene Tiso_gene_18529
- right end position:
- 2963
- transcription direction:
- NEGATIVE
- left end position:
- 1
- centisome position:
- 3.37495800e-2
- Synonym(s):
Reactions associated
- Reaction: 1-PHOSPHATIDYLINOSITOL-KINASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation