Difference between revisions of "Tiso gene 18744"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C...")
 
(Created page with "Category:Gene == Gene Tiso_gene_18744 == * right end position: ** 2795 * transcription direction: ** POSITIVE * left end position: ** 2624 * centisome position: ** 93.0166...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] ==
+
== Gene Tiso_gene_18744 ==
* smiles:
+
* right end position:
** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
+
** 2795
* inchi key:
+
* transcription direction:
** InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N
+
** POSITIVE
* common name:
+
* left end position:
** 14-oxolanosterol
+
** 2624
* molecular weight:
+
* centisome position:
** 440.708    
+
** 93.01666    
 
* Synonym(s):
 
* Synonym(s):
** 14-oxo-lanosterol
 
** 4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN66-305]]
+
* Reaction: [[RXN-10642]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
* [[RXN66-304]]
+
*** Assignment: ec-number
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[UROGENDECARBOX-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[HEMESYN2-PWY]]
 +
* [[PWY0-1415]]
 +
* [[PWY-7159]]
 +
* [[PWY-5531]]
 +
* [[CHLOROPHYLL-SYN]]
 +
* [[PWY-7766]]
 +
* [[HEME-BIOSYNTHESIS-II]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=2795}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21121725 21121725]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
+
{{#set: left end position=2624}}
{{#set: inchi key=InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N}}
+
{{#set: centisome position=93.01666   }}
{{#set: common name=14-oxolanosterol}}
+
{{#set: reaction associated=RXN-10642|UROGENDECARBOX-RXN}}
{{#set: molecular weight=440.708   }}
+
{{#set: pathway associated=HEMESYN2-PWY|PWY0-1415|PWY-7159|PWY-5531|CHLOROPHYLL-SYN|PWY-7766|HEME-BIOSYNTHESIS-II}}
{{#set: common name=14-oxo-lanosterol|4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol}}
+
{{#set: consumed by=RXN66-305}}
+
{{#set: produced by=RXN66-304}}
+

Latest revision as of 20:11, 21 March 2018

Gene Tiso_gene_18744

  • right end position:
    • 2795
  • transcription direction:
    • POSITIVE
  • left end position:
    • 2624
  • centisome position:
    • 93.01666
  • Synonym(s):

Reactions associated

Pathways associated

External links