Difference between revisions of "Tiso gene 19642"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_10268 == * left end position: ** 290 * transcription direction: ** NEGATIVE * right end position: ** 2030 * centisome position: ** 3.341014...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7015 CPD-7015] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_10268 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7015 CPD-7015] ==
−
* left end position:
+
* smiles:
−
** 290
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
−
* transcription direction:
+
* common name:
−
** NEGATIVE
+
** 71-hydroxychlorophyllide a
−
* right end position:
+
* molecular weight:
−
** 2030
+
** 628.966    
−
* centisome position:
+
−
** 3.341014    
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 7-hydroxychlorophyllide a (misleading)
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
+
* [[RXN-7677]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
* [[RXN-7676]]
−
** experimental_annotation
+
== Reaction(s) of unknown directionality ==
−
***ec-number
+
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=290}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657206 90657206]
−
{{#set: right end position=2030}}
+
* LIGAND-CPD:
−
{{#set: centisome position=3.341014    }}
+
** [http://www.genome.jp/dbget-bin/www_bget?C16540 C16540]
−
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
 +
{{#set: common name=71-hydroxychlorophyllide a}}
 +
{{#set: molecular weight=628.966    }}
 +
{{#set: common name=7-hydroxychlorophyllide a (misleading)}}
 +
{{#set: consumed by=RXN-7677}}
 +
{{#set: produced by=RXN-7676}}

Revision as of 17:45, 10 January 2018

Metabolite CPD-7015

  • smiles:
    • C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
  • common name:
    • 71-hydroxychlorophyllide a
  • molecular weight:
    • 628.966
  • Synonym(s):
    • 7-hydroxychlorophyllide a (misleading)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_19642&oldid=14439"