Difference between revisions of "Tiso gene 2021"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_2121 == * Synonym(s): == Reactions associated == * UDPNACETYLMURAMATEDEHYDROG-RXN ** in-silico_annotation ***ec-number == Pathways ass...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VAL VAL] == * smiles: ** CC(C)C([N+])C([O-])=O * inchi key: ** InChIKey=KZSNJWFQEVHDMF-BYPYZUCN...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VAL VAL] == |
| + | * smiles: | ||
| + | ** CC(C)C([N+])C([O-])=O | ||
| + | * inchi key: | ||
| + | ** InChIKey=KZSNJWFQEVHDMF-BYPYZUCNSA-N | ||
| + | * common name: | ||
| + | ** L-valine | ||
| + | * molecular weight: | ||
| + | ** 117.147 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** V | ||
| + | ** val | ||
| + | ** valine | ||
| + | ** L-val | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[VALINE--TRNA-LIGASE-RXN]] |
| − | * | + | * [[RME144]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | * [[ | + | * [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]] |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 72-18-4 |
| − | {{#set: | + | * METABOLIGHTS : MTBLC57762 |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971018 6971018] | ||
| + | * HMDB : HMDB00883 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00183 C00183] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57762 57762] | ||
| + | * BIGG : val__L | ||
| + | {{#set: smiles=CC(C)C([N+])C([O-])=O}} | ||
| + | {{#set: inchi key=InChIKey=KZSNJWFQEVHDMF-BYPYZUCNSA-N}} | ||
| + | {{#set: common name=L-valine}} | ||
| + | {{#set: molecular weight=117.147 }} | ||
| + | {{#set: common name=V|val|valine|L-val}} | ||
| + | {{#set: consumed by=VALINE--TRNA-LIGASE-RXN|RME144}} | ||
| + | {{#set: consumed or produced by=BRANCHED-CHAINAMINOTRANSFERVAL-RXN}} | ||
Revision as of 18:01, 10 January 2018
Contents
Metabolite VAL
- smiles:
- CC(C)C([N+])C([O-])=O
- inchi key:
- InChIKey=KZSNJWFQEVHDMF-BYPYZUCNSA-N
- common name:
- L-valine
- molecular weight:
- 117.147
- Synonym(s):
- V
- val
- valine
- L-val
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 72-18-4
- METABOLIGHTS : MTBLC57762
- PUBCHEM:
- HMDB : HMDB00883
- LIGAND-CPD:
- CHEBI:
- BIGG : val__L
"CC(C)C([N+])C([O-])=O" cannot be used as a page name in this wiki.
