Difference between revisions of "Tiso gene 2166"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17382 CPD-17382] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)...")
(Created page with "Category:Gene == Gene Tiso_gene_2166 == * right end position: ** 8814 * transcription direction: ** POSITIVE * left end position: ** 6922 * centisome position: ** 34.06831...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17382 CPD-17382] ==
+
== Gene Tiso_gene_2166 ==
* smiles:
+
* right end position:
** CCC=CCC=CCC=CCC=CCC=CCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 8814
* inchi key:
+
* transcription direction:
** InChIKey=DRQAURCKCKDINZ-KPYXOPPTSA-J
+
** POSITIVE
* common name:
+
* left end position:
** (3R)-hydroxy-tetracosapentaenoyl-CoA
+
** 6922
* molecular weight:
+
* centisome position:
** 1120.05    
+
** 34.068314    
 
* Synonym(s):
 
* Synonym(s):
** (3R)-hydroxy-(9Z,12Z,15Z,18Z,21Z)-tetracosapentaenoyl-CoA
 
** (3R)-hydroxy-all-cis-9,12,15,18,21-tetracosapentaenoyl-CoA
 
** (3R)-hydroxy-(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-16130]]
+
* Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
* [[RXN-16129]]
+
*** Assignment: automated-name-match
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=8814}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72551545 72551545]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: left end position=6922}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76462 76462]
+
{{#set: centisome position=34.068314   }}
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
{{#set: inchi key=InChIKey=DRQAURCKCKDINZ-KPYXOPPTSA-J}}
+
{{#set: common name=(3R)-hydroxy-tetracosapentaenoyl-CoA}}
+
{{#set: molecular weight=1120.05   }}
+
{{#set: common name=(3R)-hydroxy-(9Z,12Z,15Z,18Z,21Z)-tetracosapentaenoyl-CoA|(3R)-hydroxy-all-cis-9,12,15,18,21-tetracosapentaenoyl-CoA|(3R)-hydroxy-(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoyl-CoA}}
+
{{#set: consumed by=RXN-16130}}
+
{{#set: produced by=RXN-16129}}
+

Latest revision as of 20:56, 21 March 2018

Gene Tiso_gene_2166

  • right end position:
    • 8814
  • transcription direction:
    • POSITIVE
  • left end position:
    • 6922
  • centisome position:
    • 34.068314
  • Synonym(s):

Reactions associated

Pathways associated

External links