Difference between revisions of "Tiso gene 2190"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11526 CPD-11526] == * smiles: ** CCC=CCC4(C(=O)CCC(CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
(Created page with "Category:Gene == Gene Tiso_gene_2190 == * right end position: ** 17275 * transcription direction: ** NEGATIVE * left end position: ** 16369 * centisome position: ** 80.994...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11526 CPD-11526] ==
+
== Gene Tiso_gene_2190 ==
−
* smiles:
+
* right end position:
−
** CCC=CCC4(C(=O)CCC(CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
+
** 17275
−
* common name:
+
* transcription direction:
−
** OPC4-trans-2-enoyl-CoA
+
** NEGATIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=QSAQFDYWYNLXEC-RBHATRMTSA-J
+
** 16369
−
* molecular weight:
+
* centisome position:
−
** 981.797    
+
** 80.99456    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10705]]
+
* Reaction: [[3.1.3.16-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-10707]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=17275}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237329 44237329]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CCC=CCC4(C(=O)CCC(CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}}
+
{{#set: left end position=16369}}
−
{{#set: common name=OPC4-trans-2-enoyl-CoA}}
+
{{#set: centisome position=80.99456   }}
−
{{#set: inchi key=InChIKey=QSAQFDYWYNLXEC-RBHATRMTSA-J}}
+
{{#set: reaction associated=3.1.3.16-RXN}}
−
{{#set: molecular weight=981.797   }}
+
−
{{#set: consumed by=RXN-10705}}
+
−
{{#set: produced by=RXN-10707}}
+

Latest revision as of 21:23, 21 March 2018

Gene Tiso_gene_2190

  • right end position:
    • 17275
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 16369
  • centisome position:
    • 80.99456
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_2190&oldid=48285"