Difference between revisions of "Tiso gene 2350"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARATHION PARATHION] == * smiles: ** CCOP(OC1(C=CC(=CC=1)[N+](=O)[O-]))(OCC)=S * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14693 RXN-14693] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14693 RXN-14693] == |
− | + | * direction: | |
− | + | ** REVERSIBLE | |
− | + | ||
− | + | ||
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[D-Glucopyranuronate]][c] '''<=>''' 1 [[CPD-15530]][c] | |
− | == | + | * With common name(s): |
+ | ** 1 D-glucopyranuronate[c] '''<=>''' 1 aldehydo-D-glucuronate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[PWY-5525]], D-glucuronate degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5525 PWY-5525] | ||
+ | ** '''1''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PWY3DJ-35471]], L-ascorbate biosynthesis IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY3DJ-35471 PWY3DJ-35471] | ||
+ | ** '''2''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[PWY-7247]], β-D-glucuronide and D-glucuronate degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7247 PWY-7247] | ||
+ | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: in pathway=PWY-5525|PWY3DJ-35471|PWY-7247}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 19:10, 18 March 2018
Contents
Reaction RXN-14693
- direction:
- REVERSIBLE
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 D-Glucopyranuronate[c] <=> 1 CPD-15530[c]
- With common name(s):
- 1 D-glucopyranuronate[c] <=> 1 aldehydo-D-glucuronate[c]
Genes associated with this reaction
Pathways
- PWY-5525, D-glucuronate degradation I: PWY-5525
- 1 reactions found over 5 reactions in the full pathway
- PWY3DJ-35471, L-ascorbate biosynthesis IV: PWY3DJ-35471
- 2 reactions found over 6 reactions in the full pathway
- PWY-7247, β-D-glucuronide and D-glucuronate degradation: PWY-7247
- 3 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation