Difference between revisions of "Tiso gene 2350"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] == * smiles: ** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3))) * in...") |
(Created page with "Category:Gene == Gene Tiso_gene_2350 == * Synonym(s): == Reactions associated == * Reaction: 2.7.1.68-RXN ** Source: orthology-athaliana == Pathways associated ==...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_2350 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[2.7.1.68-RXN]] | |
− | * [[ | + | ** Source: [[orthology-athaliana]] |
− | == | + | == Pathways associated == |
+ | * [[PWY-6352]] | ||
+ | * [[PWY-6351]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=2.7.1.68-RXN}} | |
− | + | {{#set: pathway associated=PWY-6352|PWY-6351}} | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 20:25, 21 March 2018
Gene Tiso_gene_2350
- Synonym(s):
Reactions associated
- Reaction: 2.7.1.68-RXN
- Source: orthology-athaliana