Difference between revisions of "Tiso gene 2478"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19203 CPD-19203] == * smiles: ** C(O)C(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C([O-])=O)C2(C...") |
|||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19203 CPD-19203] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C(O)C(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C([O-])=O)C2(C=CC(O)=CC=2) |
| + | * inchi key: | ||
| + | ** InChIKey=ZYPJZNYMRGJBEP-XHSDSOJGSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** D-4-hydroxyphenylglycine-L-seryl-L 4-hydroxyphenylglycine |
| + | * molecular weight: | ||
| + | ** 403.391 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** D-pHPG-L-Ser-L-pHPG |
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * [[ | + | * [[RXN-17832]] |
| − | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: smiles=C(O)C(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C([O-])=O)C2(C=CC(O)=CC=2)}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=ZYPJZNYMRGJBEP-XHSDSOJGSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=D-4-hydroxyphenylglycine-L-seryl-L 4-hydroxyphenylglycine}} |
| − | {{#set: | + | {{#set: molecular weight=403.391 }} |
| − | {{#set: | + | {{#set: common name=D-pHPG-L-Ser-L-pHPG}} |
| − | {{#set: | + | {{#set: produced by=RXN-17832}} |
Revision as of 19:26, 18 March 2018
Contents
Metabolite CPD-19203
- smiles:
- C(O)C(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C([O-])=O)C2(C=CC(O)=CC=2)
- inchi key:
- InChIKey=ZYPJZNYMRGJBEP-XHSDSOJGSA-N
- common name:
- D-4-hydroxyphenylglycine-L-seryl-L 4-hydroxyphenylglycine
- molecular weight:
- 403.391
- Synonym(s):
- D-pHPG-L-Ser-L-pHPG
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C([O-])=O)C2(C=CC(O)=CC=2)" cannot be used as a page name in this wiki.
