Difference between revisions of "Tiso gene 2478"

Latest revision as of 20:43, 21 March 2018

@@ Line 1: / Line 1: @@
-[[Category:Metabolite]]
+[[Category:Gene]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19203 CPD-19203] ==
+== Gene Tiso_gene_2478 ==
-* smiles:
-** C(O)C(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C([O-])=O)C2(C=CC(O)=CC=2)
-* inchi key:
-** InChIKey=ZYPJZNYMRGJBEP-XHSDSOJGSA-N
-* common name:
-** D-4-hydroxyphenylglycine-L-seryl-L 4-hydroxyphenylglycine
-* molecular weight:
-** 403.391
 * Synonym(s):
-** D-pHPG-L-Ser-L-pHPG
-== Reaction(s) known to consume the compound ==
+== Reactions associated ==
-== Reaction(s) known to produce the compound ==
+* Reaction: [[1.6.5.4-RXN]]
-* [[RXN-17832]]
+** Source: [[orthology-athaliana]]
-== Reaction(s) of unknown directionality ==
+** Source: [[orthology-athaliana]]
+== Pathways associated ==
+* [[PWY-6370]]
 == External links  ==
-{{#set: smiles=C(O)C(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C([O-])=O)C2(C=CC(O)=CC=2)}}
+{{#set: reaction associated=1.6.5.4-RXN}}
-{{#set: inchi key=InChIKey=ZYPJZNYMRGJBEP-XHSDSOJGSA-N}}
+{{#set: pathway associated=PWY-6370}}
-{{#set: common name=D-4-hydroxyphenylglycine-L-seryl-L 4-hydroxyphenylglycine}}
-{{#set: molecular weight=403.391    }}
-{{#set: common name=D-pHPG-L-Ser-L-pHPG}}
-{{#set: produced by=RXN-17832}}