Difference between revisions of "Tiso gene 2843"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11411 CPD-11411] == * smiles: ** C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(=CC(I)=C(C(I)=C2...")
 
(Created page with "Category:Gene == Gene Tiso_gene_2843 == * Synonym(s): == Reactions associated == * Reaction: 3.2.1.21-RXN ** Source: orthology-esiliculosus * Reaction: RXN-1076...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11411 CPD-11411] ==
+
== Gene Tiso_gene_2843 ==
−
* smiles:
+
−
** C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(=CC(I)=C(C(I)=C2)OC3(C=C(I)C(O)=C(I)C=3))
+
−
* inchi key:
+
−
** InChIKey=XZMJVZBEXSKSSM-KFYUBCHVSA-M
+
−
* common name:
+
−
** tetraiodothyroacetate ester glucuronide
+
−
* molecular weight:
+
−
** 922.95   
+
 
* Synonym(s):
 
* Synonym(s):
−
** tetraiodothyroacetic acid ester glucuronide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.2.1.21-RXN]]
−
* [[RXN-10617]]
+
** Source: [[orthology-esiliculosus]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-10769]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-10773]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-13600]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-13602]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-13603]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14179]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-5341]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-8036]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-9674]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-3121]]
 +
* [[PWY-6002]]
 +
* [[PWY-6788]]
 +
* [[PWY-5176]]
 +
* [[PWY-7092]]
 +
* [[PWY-7091]]
 +
* [[PWY-7089]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: reaction associated=3.2.1.21-RXN|RXN-10769|RXN-10773|RXN-13600|RXN-13602|RXN-13603|RXN-14179|RXN-5341|RXN-8036|RXN-9674}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657880 90657880]
+
{{#set: pathway associated=PWY-3121|PWY-6002|PWY-6788|PWY-5176|PWY-7092|PWY-7091|PWY-7089}}
−
{{#set: smiles=C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(=CC(I)=C(C(I)=C2)OC3(C=C(I)C(O)=C(I)C=3))}}
+
−
{{#set: inchi key=InChIKey=XZMJVZBEXSKSSM-KFYUBCHVSA-M}}
+
−
{{#set: common name=tetraiodothyroacetate ester glucuronide}}
+
−
{{#set: molecular weight=922.95    }}
+
−
{{#set: common name=tetraiodothyroacetic acid ester glucuronide}}
+
−
{{#set: produced by=RXN-10617}}
+

Latest revision as of 20:46, 21 March 2018

Gene Tiso_gene_2843

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_2843&oldid=43705"