Difference between revisions of "Tiso gene 2987"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE PYRIDOXAMINE] == * smiles: ** CC1(=NC=C(CO)C(C[N+])=C(O)1) * common name: ** pyrid...") |
(Created page with "Category:Gene == Gene Tiso_gene_2987 == * right end position: ** 12125 * transcription direction: ** POSITIVE * left end position: ** 8335 * centisome position: ** 46.8811...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_2987 == |
− | * | + | * right end position: |
− | ** | + | ** 12125 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 8335 |
− | * | + | * centisome position: |
− | ** | + | ** 46.88115 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[2.7.7.8-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | ** Source: [[annotation-experimental_annotation]] |
+ | *** Assignment: automated-name-match | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=12125}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=8335}} | |
− | + | {{#set: centisome position=46.88115 }} | |
− | + | {{#set: reaction associated=2.7.7.8-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 20:56, 21 March 2018
Gene Tiso_gene_2987
- right end position:
- 12125
- transcription direction:
- POSITIVE
- left end position:
- 8335
- centisome position:
- 46.88115
- Synonym(s):
Reactions associated
- Reaction: 2.7.7.8-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation