Difference between revisions of "Tiso gene 3718"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18492 CPD-18492] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCC=CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
 
(Created page with "Category:Gene == Gene Tiso_gene_3718 == * right end position: ** 16010 * transcription direction: ** POSITIVE * left end position: ** 14575 * centisome position: ** 90.331...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18492 CPD-18492] ==
+
== Gene Tiso_gene_3718 ==
−
* smiles:
+
* right end position:
−
** CCCCCC=CCC=CCC=CCC=CCC=CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 16010
−
* inchi key:
+
* transcription direction:
−
** InChIKey=UYOKHWFEUAJFMG-UIYHDVLFSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** (2E,6Z,9Z,12Z,15Z,18Z)-tetracosahexaenoyl-CoA
+
** 14575
−
* molecular weight:
+
* centisome position:
−
** 1102.034    
+
** 90.33158    
 
* Synonym(s):
 
* Synonym(s):
−
** (2E,6Z,9Z,12Z,15Z,18Z)-tetracosa-2,6,9,12,15,18-hexaenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[1.1.1.8-RXN]]
−
* [[RXN-17113]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[GLYC3PDEHYDROGBIOSYN-RXN]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-6118]]
 +
* [[PWY-7385]]
 +
* [[PWY-7411]]
 +
* [[PWY-5667]]
 +
* [[PWY0-1319]]
 +
* [[PWY-5981]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=16010}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193751 72193751]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=14575}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76364 76364]
+
{{#set: centisome position=90.33158   }}
−
{{#set: smiles=CCCCCC=CCC=CCC=CCC=CCC=CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: reaction associated=1.1.1.8-RXN|GLYC3PDEHYDROGBIOSYN-RXN}}
−
{{#set: inchi key=InChIKey=UYOKHWFEUAJFMG-UIYHDVLFSA-J}}
+
{{#set: pathway associated=PWY-6118|PWY-7385|PWY-7411|PWY-5667|PWY0-1319|PWY-5981}}
−
{{#set: common name=(2E,6Z,9Z,12Z,15Z,18Z)-tetracosahexaenoyl-CoA}}
+
−
{{#set: molecular weight=1102.034   }}
+
−
{{#set: common name=(2E,6Z,9Z,12Z,15Z,18Z)-tetracosa-2,6,9,12,15,18-hexaenoyl-CoA}}
+
−
{{#set: produced by=RXN-17113}}
+

Latest revision as of 20:51, 21 March 2018

Gene Tiso_gene_3718

  • right end position:
    • 16010
  • transcription direction:
    • POSITIVE
  • left end position:
    • 14575
  • centisome position:
    • 90.33158
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_3718&oldid=44246"