Difference between revisions of "Tiso gene 3800"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12303 CPD-12303] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC...")
 
(Created page with "Category:Gene == Gene Tiso_gene_3800 == * right end position: ** 15479 * transcription direction: ** NEGATIVE * left end position: ** 7579 * centisome position: ** 47.2771...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12303 CPD-12303] ==
+
== Gene Tiso_gene_3800 ==
−
* smiles:
+
* right end position:
−
** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC1(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)C(O)C(CO)O1))([O-])=O)C)C)C)C)C)C)C
+
** 15479
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KCROFJGXXSCHGA-YGMFIXCYSA-K
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-L-lysyl- D-alanine
+
** 7579
−
* molecular weight:
+
* centisome position:
−
** 1598.955    
+
** 47.27715    
 
* Synonym(s):
 
* Synonym(s):
−
** mur2Ac(oyl-L-Ala-γ-D-Glu-L-Lys-D-Ala)-diphosphoundecaprenol
 
−
** lipid I (tetrapeptide)
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
−
* [[RXN-11347]]
+
** Source: [[annotation-experimental_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN0-5055]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY0-1264]]
 +
* [[PWY-7388]]
 +
* [[PWY-6722]]
 +
* [[PWY-5743]]
 +
* [[PWY-5744]]
 +
* [[PWY-5789]]
 +
* [[PWY-6679]]
 +
* [[PWY-4381]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=15479}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657616 90657616]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC1(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)C(O)C(CO)O1))([O-])=O)C)C)C)C)C)C)C}}
+
{{#set: left end position=7579}}
−
{{#set: inchi key=InChIKey=KCROFJGXXSCHGA-YGMFIXCYSA-K}}
+
{{#set: centisome position=47.27715   }}
−
{{#set: common name=undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-L-lysyl- D-alanine}}
+
{{#set: reaction associated=ACETYL-COA-CARBOXYLTRANSFER-RXN|RXN0-5055}}
−
{{#set: molecular weight=1598.955   }}
+
{{#set: pathway associated=PWY0-1264|PWY-7388|PWY-6722|PWY-5743|PWY-5744|PWY-5789|PWY-6679|PWY-4381}}
−
{{#set: common name=mur2Ac(oyl-L-Ala-γ-D-Glu-L-Lys-D-Ala)-diphosphoundecaprenol|lipid I (tetrapeptide)}}
+
−
{{#set: produced by=RXN-11347}}
+

Latest revision as of 21:05, 21 March 2018

Gene Tiso_gene_3800

  • right end position:
    • 15479
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 7579
  • centisome position:
    • 47.27715
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_3800&oldid=45824"