Difference between revisions of "Tiso gene 475"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2123 CPD0-2123] == * smiles: ** CCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-N-terminal-N-Ac-L-threonine Protein-N-terminal-N-Ac-L-threonine] == * common name: ** a...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2123 CPD0-2123] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-N-terminal-N-Ac-L-threonine Protein-N-terminal-N-Ac-L-threonine] ==
* smiles:
+
** CCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=AZCVXMAPLHSIKY-HSJNEKGZSA-J
+
 
* common name:
 
* common name:
** 3-oxodecanoyl-CoA
+
** an N-terminal Nα-acetyl-L-threonyl-[protein]
* molecular weight:
+
** 931.738   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a [protein] N-terminal Nα-acetyl-L-threonine
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13617]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12490]]
+
* [[RXN-17864]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[ACACT4]]
 
 
== External links  ==
 
== External links  ==
* BIGG : 3odcoa
+
{{#set: common name=an N-terminal Nα-acetyl-L-threonyl-[protein]}}
* PUBCHEM:
+
{{#set: common name=a [protein] N-terminal Nα-acetyl-L-threonine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53262297 53262297]
+
{{#set: produced by=RXN-17864}}
* HMDB : HMDB03939
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C05265 C05265]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62548 62548]
+
* METABOLIGHTS : MTBLC28528
+
{{#set: smiles=CCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=AZCVXMAPLHSIKY-HSJNEKGZSA-J}}
+
{{#set: common name=3-oxodecanoyl-CoA}}
+
{{#set: molecular weight=931.738    }}
+
{{#set: consumed by=RXN-13617}}
+
{{#set: produced by=RXN-12490}}
+
{{#set: consumed or produced by=ACACT4}}
+

Revision as of 19:56, 18 March 2018

Metabolite Protein-N-terminal-N-Ac-L-threonine

  • common name:
    • an N-terminal Nα-acetyl-L-threonyl-[protein]
  • Synonym(s):
    • a [protein] N-terminal Nα-acetyl-L-threonine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an N-terminal Nα-acetyl-L-threonyl-[protein" cannot be used as a page name in this wiki.
"a [protein] N-terminal Nα-acetyl-L-threonine" cannot be used as a page name in this wiki.