Difference between revisions of "Tiso gene 4990"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] == * smiles: ** C12(NC(=O)NC=1C(=O)NC(=O)N2) * common name: ** urate * inchi key:...") |
(Created page with "Category:Gene == Gene Tiso_gene_4990 == * right end position: ** 2693 * transcription direction: ** POSITIVE * left end position: ** 742 * centisome position: ** 5.2796354...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_4990 == |
− | * | + | * right end position: |
− | ** | + | ** 2693 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 742 |
− | * | + | * centisome position: |
− | ** | + | ** 5.2796354 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[CATAL-RXN]] | |
− | * [[ | + | ** Source: [[orthology-synechocystis]] |
− | == | + | * Reaction: [[CYTOCHROME-C-PEROXIDASE-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | ** Source: [[annotation-experimental_annotation]] |
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5506]] | ||
+ | * [[DETOX1-PWY]] | ||
+ | * [[DETOX1-PWY-1]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=2693}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=742}} | |
− | + | {{#set: centisome position=5.2796354 }} | |
− | + | {{#set: reaction associated=CATAL-RXN|CYTOCHROME-C-PEROXIDASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-5506|DETOX1-PWY|DETOX1-PWY-1}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 20:23, 21 March 2018
Gene Tiso_gene_4990
- right end position:
- 2693
- transcription direction:
- POSITIVE
- left end position:
- 742
- centisome position:
- 5.2796354
- Synonym(s):
Reactions associated
- Reaction: CATAL-RXN
- Source: orthology-synechocystis
- Reaction: CYTOCHROME-C-PEROXIDASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation