Difference between revisions of "Tiso gene 514"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7682 CPD-7682] == * smiles: ** C(C1(CCCC=N1))([O-])=O * inchi key: ** InChIKey=CSDPVAKVEWET...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-hydroxypimeloyl-ACP-methyl-esters 3-hydroxypimeloyl-ACP-methyl-esters] == * common name: ** a...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7682 CPD-7682] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-hydroxypimeloyl-ACP-methyl-esters 3-hydroxypimeloyl-ACP-methyl-esters] ==
−
* smiles:
+
−
** C(C1(CCCC=N1))([O-])=O
+
−
* inchi key:
+
−
** InChIKey=CSDPVAKVEWETFG-YFKPBYRVSA-M
+
 
* common name:
 
* common name:
−
** (S)-2,3,4,5-tetrahydropiperidine-2-carboxylate
+
** a (3R)-3-hydroxypimeloyl-[acp] methyl ester
−
* molecular weight:
+
−
** 126.135   
+
 
* Synonym(s):
 
* Synonym(s):
−
** Δ1-piperideine-6-carboxylate
+
** a 3-hydroxypimeloyl-[acyl-carrier protein] methyl ester
−
** Δ6-piperideine-2-carboxylate
+
** a 3-hydroxypimeloyl-[acp] methyl ester
−
** 1,6-didehydropiperidine-2-carboxylate
+
−
** 2,3,4,5-tetrahydropyridine-2-carboxylate
+
−
** 1-piperideine 6-carboxylate
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-8162]]
+
* [[RXN-11481]]
−
* [[RXN-10855]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11480]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[RXN-8173]]
 
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: common name=a (3R)-3-hydroxypimeloyl-[acp] methyl ester}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00450 C00450]
+
{{#set: common name=a 3-hydroxypimeloyl-[acyl-carrier protein] methyl ester|a 3-hydroxypimeloyl-[acp] methyl ester}}
−
* CHEBI:
+
{{#set: consumed by=RXN-11481}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58769 58769]
+
{{#set: produced by=RXN-11480}}
−
* METABOLIGHTS : MTBLC58769
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266761 45266761]
+
−
* HMDB : HMDB59657
+
−
{{#set: smiles=C(C1(CCCC=N1))([O-])=O}}
+
−
{{#set: inchi key=InChIKey=CSDPVAKVEWETFG-YFKPBYRVSA-M}}
+
−
{{#set: common name=(S)-2,3,4,5-tetrahydropiperidine-2-carboxylate}}
+
−
{{#set: molecular weight=126.135    }}
+
−
{{#set: common name=Δ1-piperideine-6-carboxylate|Δ6-piperideine-2-carboxylate|1,6-didehydropiperidine-2-carboxylate|2,3,4,5-tetrahydropyridine-2-carboxylate|1-piperideine 6-carboxylate}}
+
−
{{#set: consumed by=RXN-8162|RXN-10855}}
+
−
{{#set: reversible reaction associated=RXN-8173}}
+

Revision as of 16:48, 21 March 2018

Metabolite 3-hydroxypimeloyl-ACP-methyl-esters

  • common name:
    • a (3R)-3-hydroxypimeloyl-[acp] methyl ester
  • Synonym(s):
    • a 3-hydroxypimeloyl-[acyl-carrier protein] methyl ester
    • a 3-hydroxypimeloyl-[acp] methyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a (3R)-3-hydroxypimeloyl-[acp] methyl ester" cannot be used as a page name in this wiki.
  • "a 3-hydroxypimeloyl-[acyl-carrier protein] methyl ester" cannot be used as a page name in this wiki.
  • "a 3-hydroxypimeloyl-[acp] methyl ester" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_514&oldid=36413"