Difference between revisions of "Tiso gene 596"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14736 CPD-14736] == * smiles: ** C(=O)([O-])C([N+])CC(=O)C1(=C(N)C=CC=C1) * inchi key: ** I...") |
(Created page with "Category:Gene == Gene Tiso_gene_596 == * right end position: ** 5474 * transcription direction: ** POSITIVE * left end position: ** 85 * centisome position: ** 0.27321526...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_596 == |
− | * | + | * right end position: |
− | ** | + | ** 5474 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 85 |
− | * | + | * centisome position: |
− | ** | + | ** 0.27321526 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[2.7.1.90-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: ec-number | |
− | * [[ | + | ** Source: [[annotation-experimental_annotation]] |
− | == | + | *** Assignment: ec-number |
− | * [[ | + | * Reaction: [[6PFRUCTPHOS-RXN]] |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-1042]] | ||
+ | * [[GLYCOLYSIS]] | ||
+ | * [[PWY-7385]] | ||
+ | * [[PWY-1861]] | ||
+ | * [[ANAGLYCOLYSIS-PWY]] | ||
+ | * [[PWY-5484]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=5474}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=85}} | |
− | + | {{#set: centisome position=0.27321526 }} | |
− | + | {{#set: reaction associated=2.7.1.90-RXN|6PFRUCTPHOS-RXN}} | |
− | + | {{#set: pathway associated=PWY-1042|GLYCOLYSIS|PWY-7385|PWY-1861|ANAGLYCOLYSIS-PWY|PWY-5484}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + |
Latest revision as of 21:17, 21 March 2018
Gene Tiso_gene_596
- right end position:
- 5474
- transcription direction:
- POSITIVE
- left end position:
- 85
- centisome position:
- 0.27321526
- Synonym(s):
Reactions associated
- Reaction: 2.7.1.90-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: 6PFRUCTPHOS-RXN
- Source: orthology-esiliculosus