Difference between revisions of "Tiso gene 6134"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14706 CPD-14706] == * smiles: ** CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-] * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAP-Kinase-L-Phosphothreonine MAP-Kinase-L-Phosphothreonine] == * common name: ** a [mitogen-ac...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAP-Kinase-L-Phosphothreonine MAP-Kinase-L-Phosphothreonine] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a [mitogen-activated protein kinase] L-threonine phosphate |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[2.7.12.2-RXN]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a [mitogen-activated protein kinase] L-threonine phosphate}} | |
− | + | {{#set: reversible reaction associated=2.7.12.2-RXN}} | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 16:12, 21 March 2018
Contents
Metabolite MAP-Kinase-L-Phosphothreonine
- common name:
- a [mitogen-activated protein kinase] L-threonine phosphate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a [mitogen-activated protein kinase] L-threonine phosphate" cannot be used as a page name in this wiki.