Difference between revisions of "Tiso gene 6277"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19160 CPD-19160] == * smiles: ** CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=TRESYN-PWY TRESYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-6656 TA...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19160 CPD-19160] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=TRESYN-PWY TRESYN-PWY] ==
−
* smiles:
+
* taxonomic range:
−
** CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-6656 TAX-6656]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
** InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 
* common name:
 
* common name:
−
** 3-oxo-(11Z)-octadecenoyl-CoA
+
** trehalose biosynthesis I
−
* molecular weight:
+
−
** 1041.936   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxo-18:1-Δ11-CoA
+
** trehalose biosynthesis
−
** 3-oxo-11-cis-octadecenoyl-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-17787]]
+
'''2''' reactions found over '''2''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[TREHALOSE6PSYN-RXN]]
−
* [[RXN-17786]]
+
** 5 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_14367]]
 +
*** [[Tiso_gene_6869]]
 +
*** [[Tiso_gene_14220]]
 +
*** [[Tiso_gene_14366]]
 +
*** [[Tiso_gene_18196]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[TREHALOSEPHOSPHA-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_10840]]
 +
*** [[Tiso_gene_18196]]
 +
*** [[Tiso_gene_14220]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
* ECOCYC:
−
{{#set: inchi key=InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J}}
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=TRESYN-PWY TRESYN-PWY]
−
{{#set: common name=3-oxo-(11Z)-octadecenoyl-CoA}}
+
{{#set: taxonomic range=TAX-6656}}
−
{{#set: molecular weight=1041.936    }}
+
{{#set: taxonomic range=TAX-2}}
−
{{#set: common name=3-oxo-18:1-Δ11-CoA|3-oxo-11-cis-octadecenoyl-CoA}}
+
{{#set: taxonomic range=TAX-4751}}
−
{{#set: consumed by=RXN-17787}}
+
{{#set: common name=trehalose biosynthesis I}}
−
{{#set: produced by=RXN-17786}}
+
{{#set: common name=trehalose biosynthesis}}
 +
{{#set: reaction found=2}}
 +
{{#set: total reaction=2}}
 +
{{#set: completion rate=100.0}}

Revision as of 15:48, 21 March 2018

Pathway TRESYN-PWY

  • taxonomic range:
  • common name:
    • trehalose biosynthesis I
  • Synonym(s):
    • trehalose biosynthesis

Reaction(s) found

2 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_6277&oldid=30267"