Difference between revisions of "Tiso gene 65"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] == * smiles: ** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2)) * common name: ** 5'-hydr...") |
(Created page with "Category:Gene == Gene Tiso_gene_65 == * right end position: ** 42238 * transcription direction: ** POSITIVE * left end position: ** 41134 * centisome position: ** 78.07683...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_65 == |
− | * | + | * right end position: |
− | ** | + | ** 42238 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 41134 |
− | * | + | * centisome position: |
− | ** | + | ** 78.076836 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[F16ALDOLASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[FPGPL]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[RXN-8631]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[SEDOBISALDOL-RXN]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-1042]] | ||
+ | * [[P341-PWY]] | ||
+ | * [[PWY66-399]] | ||
+ | * [[PWY66-373]] | ||
+ | * [[SUCSYN-PWY]] | ||
+ | * [[GLYCOLYSIS]] | ||
+ | * [[PWY-7385]] | ||
+ | * [[ANAGLYCOLYSIS-PWY]] | ||
+ | * [[CALVIN-PWY]] | ||
+ | * [[PWY0-1517]] | ||
+ | * [[PWY-1861]] | ||
+ | * [[PWY-6142]] | ||
+ | * [[PWY-5484]] | ||
+ | * [[P185-PWY]] | ||
+ | * [[GLUCONEO-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=42238}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=41134}} | |
− | + | {{#set: centisome position=78.076836 }} | |
− | + | {{#set: reaction associated=F16ALDOLASE-RXN|FPGPL|RXN-8631|SEDOBISALDOL-RXN}} | |
− | {{#set: | + | {{#set: pathway associated=PWY-1042|P341-PWY|PWY66-399|PWY66-373|SUCSYN-PWY|GLYCOLYSIS|PWY-7385|ANAGLYCOLYSIS-PWY|CALVIN-PWY|PWY0-1517|PWY-1861|PWY-6142|PWY-5484|P185-PWY|GLUCONEO-PWY}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:54, 21 March 2018
Gene Tiso_gene_65
- right end position:
- 42238
- transcription direction:
- POSITIVE
- left end position:
- 41134
- centisome position:
- 78.076836
- Synonym(s):
Reactions associated
- Reaction: F16ALDOLASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation
- Reaction: FPGPL
- Source: orthology-creinhardtii
- Reaction: RXN-8631
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: SEDOBISALDOL-RXN
- Source: orthology-athaliana
- Source: orthology-athaliana
- Source: orthology-creinhardtii
Pathways associated
- PWY-1042
- P341-PWY
- PWY66-399
- PWY66-373
- SUCSYN-PWY
- GLYCOLYSIS
- PWY-7385
- ANAGLYCOLYSIS-PWY
- CALVIN-PWY
- PWY0-1517
- PWY-1861
- PWY-6142
- PWY-5484
- P185-PWY
- GLUCONEO-PWY