Difference between revisions of "Tiso gene 6766"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17638 CPD-17638] == * smiles: ** CCCCCC(O)CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
(Created page with "Category:Gene == Gene Tiso_gene_12435 == * Synonym(s): == Reactions associated == * Reaction: SHIKIMATE-KINASE-RXN ** Source: orthology-esiliculosus == Pathways a...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17638 CPD-17638] ==
+
== Gene Tiso_gene_12435 ==
* smiles:
+
** CCCCCC(O)CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=RXEDUSGPUQQZEW-XIRPNGCASA-J
+
* common name:
+
** 7-hydroxylauroyl-CoA
+
* molecular weight:
+
** 961.807   
+
 
* Synonym(s):
 
* Synonym(s):
** 7-hydroxydodecanoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[SHIKIMATE-KINASE-RXN]]
* [[RXN-12184]]
+
** Source: [[orthology-esiliculosus]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-6163]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=SHIKIMATE-KINASE-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819849 91819849]
+
{{#set: pathway associated=PWY-6163}}
{{#set: smiles=CCCCCC(O)CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=RXEDUSGPUQQZEW-XIRPNGCASA-J}}
+
{{#set: common name=7-hydroxylauroyl-CoA}}
+
{{#set: molecular weight=961.807    }}
+
{{#set: common name=7-hydroxydodecanoyl-CoA}}
+
{{#set: produced by=RXN-12184}}
+

Revision as of 15:53, 21 March 2018

Gene Tiso_gene_12435

  • Synonym(s):

Reactions associated

Pathways associated

External links