Difference between revisions of "Tiso gene 6766"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17638 CPD-17638] == * smiles: ** CCCCCC(O)CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
(Created page with "Category:Gene == Gene Tiso_gene_6766 == * right end position: ** 10625 * transcription direction: ** NEGATIVE * left end position: ** 8741 * centisome position: ** 73.7201...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17638 CPD-17638] ==
+
== Gene Tiso_gene_6766 ==
−
* smiles:
+
* right end position:
−
** CCCCCC(O)CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 10625
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RXEDUSGPUQQZEW-XIRPNGCASA-J
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** 7-hydroxylauroyl-CoA
+
** 8741
−
* molecular weight:
+
* centisome position:
−
** 961.807    
+
** 73.72016    
 
* Synonym(s):
 
* Synonym(s):
−
** 7-hydroxydodecanoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[1.2.1.13-RXN]]
−
* [[RXN-12184]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[GAPOXNPHOSPHN-RXN]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-1042]]
 +
* [[PWY66-399]]
 +
* [[GLUCONEO-PWY]]
 +
* [[GLYCOLYSIS]]
 +
* [[PWY-6901]]
 +
* [[SUCSYN-PWY]]
 +
* [[P124-PWY]]
 +
* [[CALVIN-PWY]]
 +
* [[ANAGLYCOLYSIS-PWY]]
 +
* [[PWY-5484]]
 +
* [[P185-PWY]]
 +
* [[P122-PWY]]
 +
* [[PWY-7003]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=10625}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819849 91819849]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CCCCCC(O)CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=8741}}
−
{{#set: inchi key=InChIKey=RXEDUSGPUQQZEW-XIRPNGCASA-J}}
+
{{#set: centisome position=73.72016   }}
−
{{#set: common name=7-hydroxylauroyl-CoA}}
+
{{#set: reaction associated=1.2.1.13-RXN|GAPOXNPHOSPHN-RXN}}
−
{{#set: molecular weight=961.807   }}
+
{{#set: pathway associated=PWY-1042|PWY66-399|GLUCONEO-PWY|GLYCOLYSIS|PWY-6901|SUCSYN-PWY|P124-PWY|CALVIN-PWY|ANAGLYCOLYSIS-PWY|PWY-5484|P185-PWY|P122-PWY|PWY-7003}}
−
{{#set: common name=7-hydroxydodecanoyl-CoA}}
+
−
{{#set: produced by=RXN-12184}}
+

Latest revision as of 20:16, 21 March 2018

Gene Tiso_gene_6766

  • right end position:
    • 10625
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 8741
  • centisome position:
    • 73.72016
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_6766&oldid=40532"