Difference between revisions of "Tiso gene 6885"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11673 CPD-11673] == * smiles: ** C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3)) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12124 RXN-12124] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-5-alpha-steroid_4-deh...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12124 RXN-12124] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** 5- | + | ** 3-oxo-5-alpha-steroid_4-dehydrogenase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.3.99.5 EC-1.3.99.5] |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[Acceptor]][c] '''+''' 1 [[CPD-342]][c] '''=>''' 1 [[Donor-H2]][c] '''+''' 1 [[ANDROST4ENE]][c] |
− | == | + | * With common name(s): |
+ | ** 1 an oxidized electron acceptor[c] '''+''' 1 5α-androstane-3,17-dione[c] '''=>''' 1 a reduced electron acceptor[c] '''+''' 1 androst-4-ene-3,17-dione[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_14327]] | ||
+ | ** IN-SILICO_ANNOTATION | ||
+ | ***EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-6943]], testosterone and androsterone degradation to androstendione: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6943 PWY-6943] | ||
+ | ** '''1''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=3-oxo-5-alpha-steroid_4-dehydrogenase}} | |
− | {{#set: | + | {{#set: ec number=EC-1.3.99.5}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_14327}} |
− | {{#set: | + | {{#set: in pathway=PWY-6943}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation}} |
+ | {{#set: reconstruction tool=pathwaytools}} |
Revision as of 01:03, 19 March 2018
Contents
Reaction RXN-12124
- direction:
- LEFT-TO-RIGHT
- common name:
- 3-oxo-5-alpha-steroid_4-dehydrogenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Acceptor[c] + 1 CPD-342[c] => 1 Donor-H2[c] + 1 ANDROST4ENE[c]
- With common name(s):
- 1 an oxidized electron acceptor[c] + 1 5α-androstane-3,17-dione[c] => 1 a reduced electron acceptor[c] + 1 androst-4-ene-3,17-dione[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Tiso_gene_14327
- IN-SILICO_ANNOTATION
- EC-NUMBER
- IN-SILICO_ANNOTATION
Pathways
- PWY-6943, testosterone and androsterone degradation to androstendione: PWY-6943
- 1 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation