Difference between revisions of "Tiso gene 6885"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11673 CPD-11673] == * smiles: ** C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3)) *...")
(Created page with "Category:Gene == Gene Tiso_gene_6885 == * Synonym(s): == Reactions associated == * Reaction: 4.2.1.59-RXN ** Source: orthology-synechocystis * Reaction: [[ECOAH8]...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11673 CPD-11673] ==
+
== Gene Tiso_gene_6885 ==
−
* smiles:
+
−
** C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3))
+
−
* inchi key:
+
−
** InChIKey=NFLHLWRXDOXSCF-UHFFFAOYSA-N
+
−
* common name:
+
−
** 5-hydroxytryptophol glucuronide
+
−
* molecular weight:
+
−
** 353.328   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[4.2.1.59-RXN]]
−
* [[RXN-10784]]
+
** Source: [[orthology-synechocystis]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[ECOAH8]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[ENOYL-COA-HYDRAT-RXN]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[METHYLACYLYLCOA-HYDROXY-RXN]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-10697]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-10704]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-10705]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-11244]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-11477]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[RXN-11481]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[RXN-13616]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14266]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14276]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-7838]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-9537]]
 +
** Source: [[orthology-synechocystis]]
 +
* Reaction: [[RXN0-6513]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[TIGLYLCOA-HYDROXY-RXN]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-6920]]
 +
* [[PWY-6435]]
 +
* [[PWY-6519]]
 +
* [[PWY-7046]]
 +
* [[PWY-735]]
 +
* [[PWY-5109]]
 +
* [[VALDEG-PWY]]
 +
* [[PWY-5971]]
 +
* [[PWY-5138]]
 +
* [[PWY66-391]]
 +
* [[PWY-5136]]
 +
* [[PWY-7007]]
 +
* [[PWY-5994]]
 +
* [[PWY-7094]]
 +
* [[FAO-PWY]]
 +
* [[ILEUDEG-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: reaction associated=4.2.1.59-RXN|ECOAH8|ENOYL-COA-HYDRAT-RXN|METHYLACYLYLCOA-HYDROXY-RXN|RXN-10697|RXN-10704|RXN-10705|RXN-11244|RXN-11477|RXN-11481|RXN-13616|RXN-14266|RXN-14276|RXN-7838|RXN-9537|RXN0-6513|TIGLYLCOA-HYDROXY-RXN}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173086 46173086]
+
{{#set: pathway associated=PWY-6920|PWY-6435|PWY-6519|PWY-7046|PWY-735|PWY-5109|VALDEG-PWY|PWY-5971|PWY-5138|PWY66-391|PWY-5136|PWY-7007|PWY-5994|PWY-7094|FAO-PWY|ILEUDEG-PWY}}
−
{{#set: smiles=C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3))}}
+
−
{{#set: inchi key=InChIKey=NFLHLWRXDOXSCF-UHFFFAOYSA-N}}
+
−
{{#set: common name=5-hydroxytryptophol glucuronide}}
+
−
{{#set: molecular weight=353.328    }}
+
−
{{#set: produced by=RXN-10784}}
+

Latest revision as of 21:17, 21 March 2018

Gene Tiso_gene_6885

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_6885&oldid=47556"