Difference between revisions of "Tiso gene 7107"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17329 CPD-17329] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)...")
(Created page with "Category:Gene == Gene Tiso_gene_7107 == * right end position: ** 11470 * transcription direction: ** POSITIVE * left end position: ** 9641 * centisome position: ** 83.8347...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17329 CPD-17329] ==
+
== Gene Tiso_gene_7107 ==
* smiles:
+
* right end position:
** CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 11470
* inchi key:
+
* transcription direction:
** InChIKey=WSALICWLARPULC-GJYKHRJNSA-J
+
** POSITIVE
* common name:
+
* left end position:
** 3-oxo-tetracosatetraenoyl-CoA
+
** 9641
* molecular weight:
+
* centisome position:
** 1120.05    
+
** 83.834785    
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoyl-CoA
 
** 3-oxo-(9Z,12Z,15Z,18Z)-tetracosatetraenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-17109]]
+
* Reaction: [[3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[VALDEG-PWY]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=11470}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581124 71581124]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: left end position=9641}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73857 73857]
+
{{#set: centisome position=83.834785   }}
{{#set: smiles=CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: reaction associated=3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN}}
{{#set: inchi key=InChIKey=WSALICWLARPULC-GJYKHRJNSA-J}}
+
{{#set: pathway associated=VALDEG-PWY}}
{{#set: common name=3-oxo-tetracosatetraenoyl-CoA}}
+
{{#set: molecular weight=1120.05   }}
+
{{#set: common name=3-oxo-(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoyl-CoA|3-oxo-(9Z,12Z,15Z,18Z)-tetracosatetraenoyl-CoA}}
+
{{#set: consumed by=RXN-17109}}
+

Latest revision as of 21:18, 21 March 2018

Gene Tiso_gene_7107

  • right end position:
    • 11470
  • transcription direction:
    • POSITIVE
  • left end position:
    • 9641
  • centisome position:
    • 83.834785
  • Synonym(s):

Reactions associated

Pathways associated

External links